C25H25N3O2S — CID 55366766
N-[4-[[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-4-oxobutyl]benzamide (PubChem CID 55366766) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[4-[[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 55366766 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[4-[[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]amino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)NCC(c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H25N3O2S/c29-24(13-6-14-26-25(30)18-8-2-1-3-9-18)28-17-21(23-12-7-15-31-23)20-16-27-22-11-5-4-10-19(20)22/h1-5,7-12,15-16,21,27H,6,13-14,17H2,(H,26,30)(H,28,29) |
| InChIKey | GUJQDDWGSRJBGL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|