C23H22N2OS2 — CID 55329076
N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 55329076) has the molecular formula C23H22N2OS2 and a molecular weight of 406.58 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 55329076 |
| Molecular Formula | C23H22N2OS2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)NCC(c2cccs2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H22N2OS2/c1-16-8-10-17(11-9-16)28-15-23(26)25-14-20(22-7-4-12-27-22)19-13-24-21-6-3-2-5-18(19)21/h2-13,20,24H,14-15H2,1H3,(H,25,26) |
| InChIKey | IGXFICFBOKCOKV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |