C20H18N4OS — CID 97191740
N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 97191740) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 97191740 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nccc(C(=O)NC[C@H](c2cccs2)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C20H18N4OS/c1-13-21-9-8-18(24-13)20(25)23-12-16(19-7-4-10-26-19)15-11-22-17-6-3-2-5-14(15)17/h2-11,16,22H,12H2,1H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | RJKQAXJEWHYFQR-INIZCTEOSA-N |
| XLogP | 3.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |