C22H21N3O2S — CID 9119210
2-ethoxy-N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]pyridine-3-carboxamide (PubChem CID 9119210) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-ethoxy-N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]pyridine-3-carboxamide.
| Compound Name | 2-ethoxy-N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9119210 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-ethoxy-N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]pyridine-3-carboxamide |
| SMILES | CCOc1ncccc1C(=O)NC[C@@H](c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H21N3O2S/c1-2-27-22-16(8-5-11-23-22)21(26)25-14-18(20-10-6-12-28-20)17-13-24-19-9-4-3-7-15(17)19/h3-13,18,24H,2,14H2,1H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | MSKWGOHONFDFED-GOSISDBHSA-N |
| XLogP | 4.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |