C18H21N3OS2 — CID 55353457
1-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-(2-methoxyethyl)thiourea (PubChem CID 55353457) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 55353457 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCC(c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H21N3OS2/c1-22-9-8-19-18(23)21-12-15(17-7-4-10-24-17)14-11-20-16-6-3-2-5-13(14)16/h2-7,10-11,15,20H,8-9,12H2,1H3,(H2,19,21,23) |
| InChIKey | VYIKRWYKXVMGQU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|