C20H23N3OS2 — CID 55353480
1-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 55353480) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 55353480 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | S=C(NCC1CCCO1)NCC(c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H23N3OS2/c25-20(22-11-14-5-3-9-24-14)23-13-17(19-8-4-10-26-19)16-12-21-18-7-2-1-6-15(16)18/h1-2,4,6-8,10,12,14,17,21H,3,5,9,11,13H2,(H2,22,23,25) |
| InChIKey | VHTVKKMHQHFURF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|