C23H24N4O3S — CID 56581131
N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 56581131) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 56581131 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C1NC(=O)C2(CCC(C(=O)NCC(c3cccs3)c3c[nH]c4ccccc34)CC2)N1 |
| InChI | InChI=1S/C23H24N4O3S/c28-20(14-7-9-23(10-8-14)21(29)26-22(30)27-23)25-13-17(19-6-3-11-31-19)16-12-24-18-5-2-1-4-15(16)18/h1-6,11-12,14,17,24H,7-10,13H2,(H,25,28)(H2,26,27,29,30) |
| InChIKey | BHRKLSSJMCSBGN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|