C25H26N4O2S — CID 42934708
4-(2-hydroxyphenyl)-N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]piperazine-1-carboxamide (PubChem CID 42934708) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-hydroxyphenyl)-N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42934708 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCC(c1cccs1)c1c[nH]c2ccccc12)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C25H26N4O2S/c30-23-9-4-3-8-22(23)28-11-13-29(14-12-28)25(31)27-17-20(24-10-5-15-32-24)19-16-26-21-7-2-1-6-18(19)21/h1-10,15-16,20,26,30H,11-14,17H2,(H,27,31) |
| InChIKey | DTDXZBSWDFSROQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |