C23H23N3OS2 — CID 8771215
1-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 8771215) has the molecular formula C23H23N3OS2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8771215 |
| Molecular Formula | C23H23N3OS2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NC[C@H](c2cccs2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H23N3OS2/c1-27-17-10-8-16(9-11-17)13-25-23(28)26-15-20(22-7-4-12-29-22)19-14-24-21-6-3-2-5-18(19)21/h2-12,14,20,24H,13,15H2,1H3,(H2,25,26,28)/t20-/m0/s1 |
| InChIKey | IRXRPDGZPKZRBF-FQEVSTJZSA-N |
| XLogP | 5.03 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|