C24H21N3O2S — CID 55556675
N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-6-methoxy-1H-indole-2-carboxamide (PubChem CID 55556675) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-6-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-6-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55556675 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-6-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NCC(c3cccs3)c3c[nH]c4ccccc34)[nH]c2c1 |
| InChI | InChI=1S/C24H21N3O2S/c1-29-16-9-8-15-11-22(27-21(15)12-16)24(28)26-14-19(23-7-4-10-30-23)18-13-25-20-6-3-2-5-17(18)20/h2-13,19,25,27H,14H2,1H3,(H,26,28) |
| InChIKey | OGGQKJIKJFUAQX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |