C25H25N3OS — CID 8766523
1-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 8766523) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8766523 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NC[C@@H](c2ccccc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H25N3OS/c1-29-20-13-11-18(12-14-20)15-27-25(30)28-16-22(19-7-3-2-4-8-19)23-17-26-24-10-6-5-9-21(23)24/h2-14,17,22,26H,15-16H2,1H3,(H2,27,28,30)/t22-/m0/s1 |
| InChIKey | QZUNUQFHTQFPMO-QFIPXVFZSA-N |
| XLogP | 4.97 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|