C19H23N3S2 — CID 42997038
1-butyl-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]thiourea (PubChem CID 42997038) has the molecular formula C19H23N3S2 and a molecular weight of 357.55 g/mol. Its IUPAC name is 1-butyl-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-butyl-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 42997038 |
| Molecular Formula | C19H23N3S2 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-butyl-3-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]thiourea |
| SMILES | CCCCNC(=S)NCC(c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H23N3S2/c1-2-3-10-20-19(23)22-13-16(18-9-6-11-24-18)15-12-21-17-8-5-4-7-14(15)17/h4-9,11-12,16,21H,2-3,10,13H2,1H3,(H2,20,22,23) |
| InChIKey | XIMUTEUFWXIETJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|