C17H20N3OS+ — CID 8645734
[(2S)-1-amino-1-oxopropan-2-yl]-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]azanium (PubChem CID 8645734) has the molecular formula C17H20N3OS+ and a molecular weight of 314.43 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl]-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]azanium.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl]-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]azanium |
|---|---|
| PubChem CID | 8645734 |
| Molecular Formula | C17H20N3OS+ |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl]-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]azanium |
| SMILES | C[C@H]([NH2+]C[C@@H](c1cccs1)c1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C17H19N3OS/c1-11(17(18)21)19-10-14(16-7-4-8-22-16)13-9-20-15-6-3-2-5-12(13)15/h2-9,11,14,19-20H,10H2,1H3,(H2,18,21)/p+1/t11-,14+/m0/s1 |
| InChIKey | VEYFIVBGTSHRDH-SMDDNHRTSA-O |
| XLogP | 1.80 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |