C14H15N2S+ — CID 2113395
[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]azanium (PubChem CID 2113395) has the molecular formula C14H15N2S+ and a molecular weight of 243.36 g/mol. Its IUPAC name is [(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]azanium.
| Compound Name | [(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]azanium |
|---|---|
| PubChem CID | 2113395 |
| Molecular Formula | C14H15N2S+ |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | [(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]azanium |
| SMILES | [NH3+]C[C@@H](c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H14N2S/c15-8-11(14-6-3-7-17-14)12-9-16-13-5-2-1-4-10(12)13/h1-7,9,11,16H,8,15H2/p+1/t11-/m1/s1 |
| InChIKey | QLJAEMUUZBSJJF-LLVKDONJSA-O |
| XLogP | 2.60 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |