C19H17N4O2S+ — CID 9194996
N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-nitropyridin-1-ium-2-amine (PubChem CID 9194996) has the molecular formula C19H17N4O2S+ and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9194996 |
| Molecular Formula | C19H17N4O2S+ |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[(2R)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-3-nitropyridin-1-ium-2-amine |
| SMILES | O=[N+]([O-])c1ccc[nH+]c1NC[C@H](c1cccs1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16N4O2S/c24-23(25)17-7-3-9-20-19(17)22-12-15(18-8-4-10-26-18)14-11-21-16-6-2-1-5-13(14)16/h1-11,15,21H,12H2,(H,20,22)/p+1/t15-/m0/s1 |
| InChIKey | YKPJBWKOZDPIRW-HNNXBMFYSA-O |
| XLogP | 4.20 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|