C20H19N3O4S3 — CID 40818667
4-N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]benzene-1,4-disulfonamide (PubChem CID 40818667) has the molecular formula C20H19N3O4S3 and a molecular weight of 461.59 g/mol. Its IUPAC name is 4-N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 40818667 |
| Molecular Formula | C20H19N3O4S3 |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 4-N-[(2S)-2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)NC[C@@H](c2cccs2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H19N3O4S3/c21-29(24,25)14-7-9-15(10-8-14)30(26,27)23-13-18(20-6-3-11-28-20)17-12-22-19-5-2-1-4-16(17)19/h1-12,18,22-23H,13H2,(H2,21,24,25)/t18-/m1/s1 |
| InChIKey | VQTFQAJDCPOMQZ-GOSISDBHSA-N |
| XLogP | 2.99 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |