C23H24N4O3S2 — CID 17448641
N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-5-morpholin-4-ylsulfonylpyridin-2-amine (PubChem CID 17448641) has the molecular formula C23H24N4O3S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-5-morpholin-4-ylsulfonylpyridin-2-amine.
| Compound Name | N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-5-morpholin-4-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 17448641 |
| Molecular Formula | C23H24N4O3S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-thiophen-2-ylethyl]-5-morpholin-4-ylsulfonylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NCC(c2cccs2)c2c[nH]c3ccccc23)nc1)N1CCOCC1 |
| InChI | InChI=1S/C23H24N4O3S2/c28-32(29,27-9-11-30-12-10-27)17-7-8-23(25-14-17)26-16-20(22-6-3-13-31-22)19-15-24-21-5-2-1-4-18(19)21/h1-8,13-15,20,24H,9-12,16H2,(H,25,26) |
| InChIKey | DAHZNQHESQESRH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |