C20H35N5O3S — CID 55521187
N-(4-methyl-2-morpholin-4-ylpentyl)-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine (PubChem CID 55521187) has the molecular formula C20H35N5O3S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-(4-methyl-2-morpholin-4-ylpentyl)-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | N-(4-methyl-2-morpholin-4-ylpentyl)-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 55521187 |
| Molecular Formula | C20H35N5O3S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-(4-methyl-2-morpholin-4-ylpentyl)-5-(4-methylpiperazin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CC(C)CC(CNc1ccc(S(=O)(=O)N2CCN(C)CC2)cn1)N1CCOCC1 |
| InChI | InChI=1S/C20H35N5O3S/c1-17(2)14-18(24-10-12-28-13-11-24)15-21-20-5-4-19(16-22-20)29(26,27)25-8-6-23(3)7-9-25/h4-5,16-18H,6-15H2,1-3H3,(H,21,22) |
| InChIKey | YACDCULCGZDMSB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |