C22H31N5O3S — CID 55431920
5-(4-methylpiperazin-1-yl)sulfonyl-N-(2-morpholin-4-yl-1-phenylethyl)pyridin-2-amine (PubChem CID 55431920) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)sulfonyl-N-(2-morpholin-4-yl-1-phenylethyl)pyridin-2-amine.
| Compound Name | 5-(4-methylpiperazin-1-yl)sulfonyl-N-(2-morpholin-4-yl-1-phenylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 55431920 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)sulfonyl-N-(2-morpholin-4-yl-1-phenylethyl)pyridin-2-amine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(CN3CCOCC3)c3ccccc3)nc2)CC1 |
| InChI | InChI=1S/C22H31N5O3S/c1-25-9-11-27(12-10-25)31(28,29)20-7-8-22(23-17-20)24-21(19-5-3-2-4-6-19)18-26-13-15-30-16-14-26/h2-8,17,21H,9-16,18H2,1H3,(H,23,24) |
| InChIKey | IGWBUXMRRNWZTL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |