C17H24N4O4S — CID 133490784
3-(furan-2-yl)-3-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]propan-1-ol (PubChem CID 133490784) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-(furan-2-yl)-3-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-(furan-2-yl)-3-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 133490784 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-(furan-2-yl)-3-[[5-(4-methylpiperazin-1-yl)sulfonyl-2-pyridinyl]amino]propan-1-ol |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(CCO)c3ccco3)nc2)CC1 |
| InChI | InChI=1S/C17H24N4O4S/c1-20-7-9-21(10-8-20)26(23,24)14-4-5-17(18-13-14)19-15(6-11-22)16-3-2-12-25-16/h2-5,12-13,15,22H,6-11H2,1H3,(H,18,19) |
| InChIKey | XVFNFSVNCKBDAU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |