C22H30N4O3S — CID 55431899
N-(2-morpholin-4-yl-1-phenylethyl)-5-piperidin-1-ylsulfonylpyridin-2-amine (PubChem CID 55431899) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-1-phenylethyl)-5-piperidin-1-ylsulfonylpyridin-2-amine.
| Compound Name | N-(2-morpholin-4-yl-1-phenylethyl)-5-piperidin-1-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 55431899 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-(2-morpholin-4-yl-1-phenylethyl)-5-piperidin-1-ylsulfonylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NC(CN2CCOCC2)c2ccccc2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C22H30N4O3S/c27-30(28,26-11-5-2-6-12-26)20-9-10-22(23-17-20)24-21(19-7-3-1-4-8-19)18-25-13-15-29-16-14-25/h1,3-4,7-10,17,21H,2,5-6,11-16,18H2,(H,23,24) |
| InChIKey | UXPDQVXFJYHPHI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |