C18H24N4O2S — CID 133316598
N-methyl-6-[(1-phenyl-2-pyrrolidin-1-ylethyl)amino]pyridine-3-sulfonamide (PubChem CID 133316598) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-methyl-6-[(1-phenyl-2-pyrrolidin-1-ylethyl)amino]pyridine-3-sulfonamide.
| Compound Name | N-methyl-6-[(1-phenyl-2-pyrrolidin-1-ylethyl)amino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133316598 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-methyl-6-[(1-phenyl-2-pyrrolidin-1-ylethyl)amino]pyridine-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(CN2CCCC2)c2ccccc2)nc1 |
| InChI | InChI=1S/C18H24N4O2S/c1-19-25(23,24)16-9-10-18(20-13-16)21-17(14-22-11-5-6-12-22)15-7-3-2-4-8-15/h2-4,7-10,13,17,19H,5-6,11-12,14H2,1H3,(H,20,21) |
| InChIKey | AZUOZKSYZXJHQF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |