C16H25N3O3S — CID 51872327
N-[(1S)-2-morpholin-4-yl-1-phenylethyl]pyrrolidine-1-sulfonamide (PubChem CID 51872327) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[(1S)-2-morpholin-4-yl-1-phenylethyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[(1S)-2-morpholin-4-yl-1-phenylethyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 51872327 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(1S)-2-morpholin-4-yl-1-phenylethyl]pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(N[C@H](CN1CCOCC1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C16H25N3O3S/c20-23(21,19-8-4-5-9-19)17-16(15-6-2-1-3-7-15)14-18-10-12-22-13-11-18/h1-3,6-7,16-17H,4-5,8-14H2/t16-/m1/s1 |
| InChIKey | BRJSFMJAIVDBSD-MRXNPFEDSA-N |
| XLogP | 0.99 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |