C14H21BrN2O2S — CID 114296872
N-(2-bromo-1-phenylethyl)azepane-1-sulfonamide (PubChem CID 114296872) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is N-(2-bromo-1-phenylethyl)azepane-1-sulfonamide.
| Compound Name | N-(2-bromo-1-phenylethyl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 114296872 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-(2-bromo-1-phenylethyl)azepane-1-sulfonamide |
| SMILES | O=S(=O)(NC(CBr)c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C14H21BrN2O2S/c15-12-14(13-8-4-3-5-9-13)16-20(18,19)17-10-6-1-2-7-11-17/h3-5,8-9,14,16H,1-2,6-7,10-12H2 |
| InChIKey | SGSVTZFBHXLYJX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|