C16H26N2O3S — CID 97239368
N-[(2R,3S)-1-hydroxy-3-phenylbutan-2-yl]azepane-1-sulfonamide (PubChem CID 97239368) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[(2R,3S)-1-hydroxy-3-phenylbutan-2-yl]azepane-1-sulfonamide.
| Compound Name | N-[(2R,3S)-1-hydroxy-3-phenylbutan-2-yl]azepane-1-sulfonamide |
|---|---|
| PubChem CID | 97239368 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[(2R,3S)-1-hydroxy-3-phenylbutan-2-yl]azepane-1-sulfonamide |
| SMILES | C[C@@H](c1ccccc1)[C@H](CO)NS(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C16H26N2O3S/c1-14(15-9-5-4-6-10-15)16(13-19)17-22(20,21)18-11-7-2-3-8-12-18/h4-6,9-10,14,16-17,19H,2-3,7-8,11-13H2,1H3/t14-,16-/m0/s1 |
| InChIKey | IMHYHHLFQBTPHY-HOCLYGCPSA-N |
| XLogP | 1.86 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |