C8H18N2O4S — CID 65314238
N-(1,3-dihydroxypropan-2-yl)piperidine-1-sulfonamide (PubChem CID 65314238) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)piperidine-1-sulfonamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 65314238 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NC(CO)CO)N1CCCCC1 |
| InChI | InChI=1S/C8H18N2O4S/c11-6-8(7-12)9-15(13,14)10-4-2-1-3-5-10/h8-9,11-12H,1-7H2 |
| InChIKey | JFRCZZGVVWPYNV-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |