About N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide (PubChem CID 107848008) has the molecular formula C9H20N2O5S
and a molecular weight of 268.33 g/mol. Its IUPAC name is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide |
| PubChem CID | 107848008 |
| Molecular Formula | C9H20N2O5S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NC(CO)(CO)CO)N1CCCCC1 |
| InChI | InChI=1S/C9H20N2O5S/c12-6-9(7-13,8-14)10-17(15,16)11-4-2-1-3-5-11/h10,12-14H,1-8H2 |
| InChIKey | NTRALARLRBGOSD-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide?
The IUPAC name of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide (CID 107848008) is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide.
What is the SMILES notation for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide?
The canonical SMILES for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide is O=S(=O)(NC(CO)(CO)CO)N1CCCCC1.
What is the InChIKey of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide?
The InChIKey is NTRALARLRBGOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O5S/c12-6-9(7-13,8-14)10-17(15,16)11-4-2-1-3-5-11/h10,12-14H,1-8H2.
What are the key properties of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide?
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide has a molecular weight of 268.33 g/mol, XLogP of -1.98, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]piperidine-1-sulfonamide is sourced from PubChem (CID 107848008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).