C7H14F2N2O3S — CID 104858688
N-(2,2-difluoro-3-hydroxypropyl)pyrrolidine-1-sulfonamide (PubChem CID 104858688) has the molecular formula C7H14F2N2O3S and a molecular weight of 244.26 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 104858688 |
| Molecular Formula | C7H14F2N2O3S |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)CO)N1CCCC1 |
| InChI | InChI=1S/C7H14F2N2O3S/c8-7(9,6-12)5-10-15(13,14)11-3-1-2-4-11/h10,12H,1-6H2 |
| InChIKey | UWAHUGLUSHZZBU-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |