C12H25ClN2O2S — CID 106146071
N-(4-chloro-2,2-dimethylbutyl)azepane-1-sulfonamide (PubChem CID 106146071) has the molecular formula C12H25ClN2O2S and a molecular weight of 296.86 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)azepane-1-sulfonamide.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 106146071 |
| Molecular Formula | C12H25ClN2O2S |
| Molecular Weight | 296.86 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)azepane-1-sulfonamide |
| SMILES | CC(C)(CCCl)CNS(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H25ClN2O2S/c1-12(2,7-8-13)11-14-18(16,17)15-9-5-3-4-6-10-15/h14H,3-11H2,1-2H3 |
| InChIKey | FAZVIODVQPAANV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|