C13H27BrN2O2S — CID 107158076
N-(2-bromo-4,4-dimethylpentyl)azepane-1-sulfonamide (PubChem CID 107158076) has the molecular formula C13H27BrN2O2S and a molecular weight of 355.34 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)azepane-1-sulfonamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 107158076 |
| Molecular Formula | C13H27BrN2O2S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)azepane-1-sulfonamide |
| SMILES | CC(C)(C)CC(Br)CNS(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C13H27BrN2O2S/c1-13(2,3)10-12(14)11-15-19(17,18)16-8-6-4-5-7-9-16/h12,15H,4-11H2,1-3H3 |
| InChIKey | FMWBCFZCMMCHGA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|