C11H23BrN2O3S — CID 107158136
N-(2-bromo-4,4-dimethylpentyl)morpholine-4-sulfonamide (PubChem CID 107158136) has the molecular formula C11H23BrN2O3S and a molecular weight of 343.29 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)morpholine-4-sulfonamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 107158136 |
| Molecular Formula | C11H23BrN2O3S |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)morpholine-4-sulfonamide |
| SMILES | CC(C)(C)CC(Br)CNS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H23BrN2O3S/c1-11(2,3)8-10(12)9-13-18(15,16)14-4-6-17-7-5-14/h10,13H,4-9H2,1-3H3 |
| InChIKey | ZKHMHPDYESKRSJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|