C10H23N3O3S — CID 106148888
N-(4-hydroxy-2,2-dimethylbutyl)piperazine-1-sulfonamide (PubChem CID 106148888) has the molecular formula C10H23N3O3S and a molecular weight of 265.38 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)piperazine-1-sulfonamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 106148888 |
| Molecular Formula | C10H23N3O3S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)piperazine-1-sulfonamide |
| SMILES | CC(C)(CCO)CNS(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H23N3O3S/c1-10(2,3-8-14)9-12-17(15,16)13-6-4-11-5-7-13/h11-12,14H,3-9H2,1-2H3 |
| InChIKey | SBUPQXCPACPGRX-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |