C12H25N3O2 — CID 106147925
N-(4-hydroxy-2,2-dimethylbutyl)-2-piperazin-1-ylacetamide (PubChem CID 106147925) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)-2-piperazin-1-ylacetamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 106147925 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)-2-piperazin-1-ylacetamide |
| SMILES | CC(C)(CCO)CNC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C12H25N3O2/c1-12(2,3-8-16)10-14-11(17)9-15-6-4-13-5-7-15/h13,16H,3-10H2,1-2H3,(H,14,17) |
| InChIKey | YQRFIPVKVMKPNR-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |