C15H35N6O+ — CID 11724349
trimethyl-[2-[[2-(1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]ethyl]azanium (PubChem CID 11724349) has the molecular formula C15H35N6O+ and a molecular weight of 315.49 g/mol. Its IUPAC name is trimethyl-[2-[[2-(1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[2-(1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 11724349 |
| Molecular Formula | C15H35N6O+ |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | trimethyl-[2-[[2-(1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]ethyl]azanium |
| SMILES | C[N+](C)(C)CCNC(=O)CN1CCNCCNCCNCC1 |
| InChI | InChI=1S/C15H34N6O/c1-21(2,3)13-10-19-15(22)14-20-11-8-17-6-4-16-5-7-18-9-12-20/h16-18H,4-14H2,1-3H3/p+1 |
| InChIKey | YKABZEFPLXCFDT-UHFFFAOYSA-O |
| XLogP | -2.11 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|