C11H21N3O3 — CID 62837481
methyl 3-[[2-(1,4-diazepan-1-yl)acetyl]amino]propanoate (PubChem CID 62837481) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is methyl 3-[[2-(1,4-diazepan-1-yl)acetyl]amino]propanoate.
| Compound Name | methyl 3-[[2-(1,4-diazepan-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 62837481 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | methyl 3-[[2-(1,4-diazepan-1-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C11H21N3O3/c1-17-11(16)3-5-13-10(15)9-14-7-2-4-12-6-8-14/h12H,2-9H2,1H3,(H,13,15) |
| InChIKey | YYSPFMQHYIBWDI-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |