C7H16N4O4S — CID 106177020
2-hydroxy-3-(piperazin-1-ylsulfonylamino)propanamide (PubChem CID 106177020) has the molecular formula C7H16N4O4S and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-hydroxy-3-(piperazin-1-ylsulfonylamino)propanamide.
| Compound Name | 2-hydroxy-3-(piperazin-1-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 106177020 |
| Molecular Formula | C7H16N4O4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-hydroxy-3-(piperazin-1-ylsulfonylamino)propanamide |
| SMILES | NC(=O)C(O)CNS(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C7H16N4O4S/c8-7(13)6(12)5-10-16(14,15)11-3-1-9-2-4-11/h6,9-10,12H,1-5H2,(H2,8,13) |
| InChIKey | AAVJQJNINIDNPT-UHFFFAOYSA-N |
| XLogP | -3.43 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |