C12H16BrNO2S — CID 69157308
1-[bromo(phenyl)methyl]sulfonylpiperidine (PubChem CID 69157308) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 1-[bromo(phenyl)methyl]sulfonylpiperidine.
| Compound Name | 1-[bromo(phenyl)methyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 69157308 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 1-[bromo(phenyl)methyl]sulfonylpiperidine |
| SMILES | O=S(=O)(C(Br)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C12H16BrNO2S/c13-12(11-7-3-1-4-8-11)17(15,16)14-9-5-2-6-10-14/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | PQMSMQMXWZNPHQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|