C21H19N4O2+ — CID 9112682
N-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-3-nitropyridin-1-ium-2-amine (PubChem CID 9112682) has the molecular formula C21H19N4O2+ and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9112682 |
| Molecular Formula | C21H19N4O2+ |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]-3-nitropyridin-1-ium-2-amine |
| SMILES | O=[N+]([O-])c1ccc[nH+]c1NC[C@@H](c1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H18N4O2/c26-25(27)20-11-6-12-22-21(20)24-13-17(15-7-2-1-3-8-15)18-14-23-19-10-5-4-9-16(18)19/h1-12,14,17,23H,13H2,(H,22,24)/p+1/t17-/m0/s1 |
| InChIKey | WIVZYSQWCQJALS-KRWDZBQOSA-O |
| XLogP | 4.13 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|