C20H18N4 — CID 55346930
N-[2-(1H-indol-3-yl)-2-phenylethyl]pyrimidin-2-amine (PubChem CID 55346930) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-phenylethyl]pyrimidin-2-amine.
| Compound Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 55346930 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]pyrimidin-2-amine |
| SMILES | c1ccc(C(CNc2ncccn2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H18N4/c1-2-7-15(8-3-1)17(13-24-20-21-11-6-12-22-20)18-14-23-19-10-5-4-9-16(18)19/h1-12,14,17,23H,13H2,(H,21,22,24) |
| InChIKey | UXBFITDVNXXXDY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |