C24H23N5 — CID 25353510
2-[[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]amino]pyridine-3-carbonitrile (PubChem CID 25353510) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-[[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 25353510 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-[[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]amino]pyridine-3-carbonitrile |
| SMILES | CN(C)c1ccc([C@H](CNc2ncccc2C#N)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H23N5/c1-29(2)19-11-9-17(10-12-19)21(15-28-24-18(14-25)6-5-13-26-24)22-16-27-23-8-4-3-7-20(22)23/h3-13,16,21,27H,15H2,1-2H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | FIQKERYVENSXEY-NRFANRHFSA-N |
| XLogP | 4.74 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|