C24H25N3 — CID 66668765
4-[1-(1H-indol-3-yl)-3-pyridin-4-ylpropyl]-N,N-dimethylaniline (PubChem CID 66668765) has the molecular formula C24H25N3 and a molecular weight of 355.49 g/mol. Its IUPAC name is 4-[1-(1H-indol-3-yl)-3-pyridin-4-ylpropyl]-N,N-dimethylaniline.
| Compound Name | 4-[1-(1H-indol-3-yl)-3-pyridin-4-ylpropyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 66668765 |
| Molecular Formula | C24H25N3 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-[1-(1H-indol-3-yl)-3-pyridin-4-ylpropyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(CCc2ccncc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H25N3/c1-27(2)20-10-8-19(9-11-20)21(12-7-18-13-15-25-16-14-18)23-17-26-24-6-4-3-5-22(23)24/h3-6,8-11,13-17,21,26H,7,12H2,1-2H3 |
| InChIKey | RPKVUPFNVUROIV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|