C22H18N4 — CID 93250153
6-[[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]amino]pyridine-3-carbonitrile (PubChem CID 93250153) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-[[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 93250153 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-[[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NC[C@@H](c2ccccc2)c2c[nH]c3ccccc23)nc1 |
| InChI | InChI=1S/C22H18N4/c23-12-16-10-11-22(25-13-16)26-14-19(17-6-2-1-3-7-17)20-15-24-21-9-5-4-8-18(20)21/h1-11,13,15,19,24H,14H2,(H,25,26)/t19-/m0/s1 |
| InChIKey | FVFQSEDEMFYRTH-IBGZPJMESA-N |
| XLogP | 4.68 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |