C22H20N4O3 — CID 9113383
N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-nitropyridin-2-amine (PubChem CID 9113383) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-nitropyridin-2-amine.
| Compound Name | N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 9113383 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-nitropyridin-2-amine |
| SMILES | COc1ccc([C@H](CNc2ncccc2[N+](=O)[O-])c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H20N4O3/c1-29-16-10-8-15(9-11-16)18(19-14-24-20-6-3-2-5-17(19)20)13-25-22-21(26(27)28)7-4-12-23-22/h2-12,14,18,24H,13H2,1H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | PXCGELCYJDTOHE-SFHVURJKSA-N |
| XLogP | 4.72 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|