C22H21N5O4 — CID 138995409
N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-2-(5-nitropyrazol-1-yl)acetamide (PubChem CID 138995409) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-2-(5-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-2-(5-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 138995409 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-2-(5-nitropyrazol-1-yl)acetamide |
| SMILES | COc1ccc(C(CNC(=O)Cn2nccc2[N+](=O)[O-])c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H21N5O4/c1-31-16-8-6-15(7-9-16)18(19-13-23-20-5-3-2-4-17(19)20)12-24-21(28)14-26-22(27(29)30)10-11-25-26/h2-11,13,18,23H,12,14H2,1H3,(H,24,28) |
| InChIKey | AZDQYXYWPZZNKX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 115.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|