C25H31N3O2 — CID 8558536
N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-2-(4-methylpiperidin-1-yl)acetamide (PubChem CID 8558536) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-2-(4-methylpiperidin-1-yl)acetamide.
| Compound Name | N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-2-(4-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 8558536 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-2-(4-methylpiperidin-1-yl)acetamide |
| SMILES | COc1ccc([C@H](CNC(=O)CN2CCC(C)CC2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-18-11-13-28(14-12-18)17-25(29)27-15-22(19-7-9-20(30-2)10-8-19)23-16-26-24-6-4-3-5-21(23)24/h3-10,16,18,22,26H,11-15,17H2,1-2H3,(H,27,29)/t22-/m0/s1 |
| InChIKey | FNLXWJWPXPHVSR-QFIPXVFZSA-N |
| XLogP | 4.16 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |