C27H35N3O2 — CID 16577880
2-[cycloheptyl(methyl)amino]-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 16577880) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-[cycloheptyl(methyl)amino]-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[cycloheptyl(methyl)amino]-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 16577880 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 2-[cycloheptyl(methyl)amino]-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C(CNC(=O)CN(C)C2CCCCCC2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H35N3O2/c1-30(21-9-5-3-4-6-10-21)19-27(31)29-17-24(20-13-15-22(32-2)16-14-20)25-18-28-26-12-8-7-11-23(25)26/h7-8,11-16,18,21,24,28H,3-6,9-10,17,19H2,1-2H3,(H,29,31) |
| InChIKey | UWLLQWYGWRLFKP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |