C28H31N3O4 — CID 55343696
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]propanamide (PubChem CID 55343696) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 55343696 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(C(CNC(=O)CCN2C(=O)C3CCCCC3C2=O)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-35-19-12-10-18(11-13-19)23(24-17-29-25-9-5-4-6-20(24)25)16-30-26(32)14-15-31-27(33)21-7-2-3-8-22(21)28(31)34/h4-6,9-13,17,21-23,29H,2-3,7-8,14-16H2,1H3,(H,30,32) |
| InChIKey | CRHMUSUJKRRHGI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|