C25H33N3O2 — CID 43061749
2-(dipropylamino)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 43061749) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-(dipropylamino)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(dipropylamino)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43061749 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 2-(dipropylamino)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | CCCN(CCC)CC(=O)NCC(c1ccc(OC)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H33N3O2/c1-4-14-28(15-5-2)18-25(29)27-16-22(19-10-12-20(30-3)13-11-19)23-17-26-24-9-7-6-8-21(23)24/h6-13,17,22,26H,4-5,14-16,18H2,1-3H3,(H,27,29) |
| InChIKey | RODCWNKEFLLCQO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |