C23H26N2O5 — CID 9289695
[2-[[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl] 2-ethoxyacetate (PubChem CID 9289695) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-[[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl] 2-ethoxyacetate.
| Compound Name | [2-[[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 9289695 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [2-[[(2S)-2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)NC[C@@H](c1ccc(OC)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H26N2O5/c1-3-29-15-23(27)30-14-22(26)25-12-19(16-8-10-17(28-2)11-9-16)20-13-24-21-7-5-4-6-18(20)21/h4-11,13,19,24H,3,12,14-15H2,1-2H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | YBEQUNOONYGOBG-IBGZPJMESA-N |
| XLogP | 3.00 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |