C27H26N4O4 — CID 55343750
4-(cyclopropylamino)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-nitrobenzamide (PubChem CID 55343750) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55343750 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-(cyclopropylamino)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]-3-nitrobenzamide |
| SMILES | COc1ccc(C(CNC(=O)c2ccc(NC3CC3)c([N+](=O)[O-])c2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H26N4O4/c1-35-20-11-6-17(7-12-20)22(23-16-28-24-5-3-2-4-21(23)24)15-29-27(32)18-8-13-25(30-19-9-10-19)26(14-18)31(33)34/h2-8,11-14,16,19,22,28,30H,9-10,15H2,1H3,(H,29,32) |
| InChIKey | WFKSNIFWSBOJAB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|